C18H27ClN2O5 — CID 122497759
N-[(2S)-1-[3-[[3-chloro-4-(2-methoxyethoxy)-2-pyridinyl]oxymethyl]cyclobutyl]oxypropan-2-yl]acetamide (PubChem CID 122497759) has the molecular formula C18H27ClN2O5 and a molecular weight of 386.88 g/mol. Its IUPAC name is N-[(2S)-1-[3-[[3-chloro-4-(2-methoxyethoxy)-2-pyridinyl]oxymethyl]cyclobutyl]oxypropan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[3-[[3-chloro-4-(2-methoxyethoxy)-2-pyridinyl]oxymethyl]cyclobutyl]oxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 122497759 |
| Molecular Formula | C18H27ClN2O5 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[(2S)-1-[3-[[3-chloro-4-(2-methoxyethoxy)-2-pyridinyl]oxymethyl]cyclobutyl]oxypropan-2-yl]acetamide |
| SMILES | COCCOc1ccnc(OCC2CC(OC[C@H](C)NC(C)=O)C2)c1Cl |
| InChI | InChI=1S/C18H27ClN2O5/c1-12(21-13(2)22)10-25-15-8-14(9-15)11-26-18-17(19)16(4-5-20-18)24-7-6-23-3/h4-5,12,14-15H,6-11H2,1-3H3,(H,21,22)/t12-,14?,15?/m0/s1 |
| InChIKey | MEWWYMQVQOXAHE-GRTSSRMGSA-N |
| XLogP | 2.46 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|