C21H31FN2O4 — CID 151266250
N-[(2S)-1-[4-[[6-(cyclopropylmethoxy)-2-fluoro-3-pyridinyl]methoxy]cyclohexyl]oxypropan-2-yl]acetamide (PubChem CID 151266250) has the molecular formula C21H31FN2O4 and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[(2S)-1-[4-[[6-(cyclopropylmethoxy)-2-fluoro-3-pyridinyl]methoxy]cyclohexyl]oxypropan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[4-[[6-(cyclopropylmethoxy)-2-fluoro-3-pyridinyl]methoxy]cyclohexyl]oxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 151266250 |
| Molecular Formula | C21H31FN2O4 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[(2S)-1-[4-[[6-(cyclopropylmethoxy)-2-fluoro-3-pyridinyl]methoxy]cyclohexyl]oxypropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)COC1CCC(OCc2ccc(OCC3CC3)nc2F)CC1 |
| InChI | InChI=1S/C21H31FN2O4/c1-14(23-15(2)25)11-26-18-6-8-19(9-7-18)27-13-17-5-10-20(24-21(17)22)28-12-16-3-4-16/h5,10,14,16,18-19H,3-4,6-9,11-13H2,1-2H3,(H,23,25)/t14-,18?,19?/m0/s1 |
| InChIKey | NVKGDKIUDMTMCG-YCMKEVRSSA-N |
| XLogP | 3.38 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|