C29H34N4O5S — CID 122499873
4-ethyl-N-[2-[4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)phenyl]ethyl]-3-methyl-5-oxo-2H-pyrrole-1-carboxamide (PubChem CID 122499873) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is 4-ethyl-N-[2-[4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)phenyl]ethyl]-3-methyl-5-oxo-2H-pyrrole-1-carboxamide.
| Compound Name | 4-ethyl-N-[2-[4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)phenyl]ethyl]-3-methyl-5-oxo-2H-pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 122499873 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 4-ethyl-N-[2-[4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)phenyl]ethyl]-3-methyl-5-oxo-2H-pyrrole-1-carboxamide |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)Nc3c4c(cc5c3CCC5)CCC4)cc2)C1=O |
| InChI | InChI=1S/C29H34N4O5S/c1-3-23-18(2)17-33(27(23)34)29(36)30-15-14-19-10-12-22(13-11-19)39(37,38)32-28(35)31-26-24-8-4-6-20(24)16-21-7-5-9-25(21)26/h10-13,16H,3-9,14-15,17H2,1-2H3,(H,30,36)(H2,31,32,35) |
| InChIKey | YCXZAPBZADBMQO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |