C30H34N4O4S — CID 142478874
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-(1-phenylethylcarbamoylamino)ethyl]phenyl]sulfonylurea (PubChem CID 142478874) has the molecular formula C30H34N4O4S and a molecular weight of 546.69 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-(1-phenylethylcarbamoylamino)ethyl]phenyl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-(1-phenylethylcarbamoylamino)ethyl]phenyl]sulfonylurea |
|---|---|
| PubChem CID | 142478874 |
| Molecular Formula | C30H34N4O4S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-(1-phenylethylcarbamoylamino)ethyl]phenyl]sulfonylurea |
| SMILES | CC(NC(=O)NCCc1ccc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H34N4O4S/c1-20(22-7-3-2-4-8-22)32-29(35)31-18-17-21-13-15-25(16-14-21)39(37,38)34-30(36)33-28-26-11-5-9-23(26)19-24-10-6-12-27(24)28/h2-4,7-8,13-16,19-20H,5-6,9-12,17-18H2,1H3,(H2,31,32,35)(H2,33,34,36) |
| InChIKey | OSFZYFXSTDCUEF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |