C25H20N4O3 — CID 122500458
14-oxa-6,7,23,25-tetrazapentacyclo[19.3.1.05,24.08,13.017,22]pentacosa-1(25),2,4,6,8(13),9,11,17(22),18,20,23-undecaen-11-ylmethyl 2-methylprop-2-enoate (PubChem CID 122500458) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 14-oxa-6,7,23,25-tetrazapentacyclo[19.3.1.05,24.08,13.017,22]pentacosa-1(25),2,4,6,8(13),9,11,17(22),18,20,23-undecaen-11-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 14-oxa-6,7,23,25-tetrazapentacyclo[19.3.1.05,24.08,13.017,22]pentacosa-1(25),2,4,6,8(13),9,11,17(22),18,20,23-undecaen-11-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122500458 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 14-oxa-6,7,23,25-tetrazapentacyclo[19.3.1.05,24.08,13.017,22]pentacosa-1(25),2,4,6,8(13),9,11,17(22),18,20,23-undecaen-11-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc2c(c1)OCCc1cccc3nc4cccc(c4nc13)/N=N\2 |
| InChI | InChI=1S/C25H20N4O3/c1-15(2)25(30)32-14-16-9-10-18-22(13-16)31-12-11-17-5-3-6-19-23(17)27-24-20(26-19)7-4-8-21(24)29-28-18/h3-10,13H,1,11-12,14H2,2H3/b29-28- |
| InChIKey | UHWCRNKXDXMWGW-ZIADKAODSA-N |
| XLogP | 5.75 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|