C17H15FO3 — CID 122501736
[4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methanol (PubChem CID 122501736) has the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methanol.
| Compound Name | [4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methanol |
|---|---|
| PubChem CID | 122501736 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [4-(4-fluorophenyl)-6-methoxy-2H-chromen-3-yl]methanol |
| SMILES | COc1ccc2c(c1)C(c1ccc(F)cc1)=C(CO)CO2 |
| InChI | InChI=1S/C17H15FO3/c1-20-14-6-7-16-15(8-14)17(12(9-19)10-21-16)11-2-4-13(18)5-3-11/h2-8,19H,9-10H2,1H3 |
| InChIKey | ZFUDDJLJXFUGAC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |