C21H23F3N2O2 — CID 122501739
N-[[6-(difluoromethoxy)-4-(4-fluorophenyl)-2H-chromen-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 122501739) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[[6-(difluoromethoxy)-4-(4-fluorophenyl)-2H-chromen-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[6-(difluoromethoxy)-4-(4-fluorophenyl)-2H-chromen-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 122501739 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[[6-(difluoromethoxy)-4-(4-fluorophenyl)-2H-chromen-3-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCC1=C(c2ccc(F)cc2)c2cc(OC(F)F)ccc2OC1 |
| InChI | InChI=1S/C21H23F3N2O2/c1-26(2)10-9-25-12-15-13-27-19-8-7-17(28-21(23)24)11-18(19)20(15)14-3-5-16(22)6-4-14/h3-8,11,21,25H,9-10,12-13H2,1-2H3 |
| InChIKey | CMVVSDCCVPWUBJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|