C21H17F4NO3 — CID 139445471
[4-(4-fluorophenyl)-6-(trifluoromethoxy)-2H-chromen-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 139445471) has the molecular formula C21H17F4NO3 and a molecular weight of 407.36 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-6-(trifluoromethoxy)-2H-chromen-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(4-fluorophenyl)-6-(trifluoromethoxy)-2H-chromen-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 139445471 |
| Molecular Formula | C21H17F4NO3 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-(4-fluorophenyl)-6-(trifluoromethoxy)-2H-chromen-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1=C(c2ccc(F)cc2)c2cc(OC(F)(F)F)ccc2OC1)N1CCCC1 |
| InChI | InChI=1S/C21H17F4NO3/c22-14-5-3-13(4-6-14)19-16-11-15(29-21(23,24)25)7-8-18(16)28-12-17(19)20(27)26-9-1-2-10-26/h3-8,11H,1-2,9-10,12H2 |
| InChIKey | PHHGLMFWAUQLDX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |