C13H14BrFO3 — CID 122502828
1-(5-bromo-2-fluorophenyl)-2-[(2S)-1-methoxybut-3-en-2-yl]oxyethanone (PubChem CID 122502828) has the molecular formula C13H14BrFO3 and a molecular weight of 317.15 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-2-[(2S)-1-methoxybut-3-en-2-yl]oxyethanone.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-2-[(2S)-1-methoxybut-3-en-2-yl]oxyethanone |
|---|---|
| PubChem CID | 122502828 |
| Molecular Formula | C13H14BrFO3 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-2-[(2S)-1-methoxybut-3-en-2-yl]oxyethanone |
| SMILES | C=C[C@@H](COC)OCC(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H14BrFO3/c1-3-10(7-17-2)18-8-13(16)11-6-9(14)4-5-12(11)15/h3-6,10H,1,7-8H2,2H3/t10-/m0/s1 |
| InChIKey | IXJYQWRTYMGFGK-JTQLQIEISA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|