C19H23FN2 — CID 122504704
1-(1-benzhydryl-3-fluoroazetidin-3-yl)-N,N-dimethylmethanamine (PubChem CID 122504704) has the molecular formula C19H23FN2 and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(1-benzhydryl-3-fluoroazetidin-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(1-benzhydryl-3-fluoroazetidin-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 122504704 |
| Molecular Formula | C19H23FN2 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(1-benzhydryl-3-fluoroazetidin-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1(F)CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C19H23FN2/c1-21(2)13-19(20)14-22(15-19)18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3 |
| InChIKey | UNASPZSZSFUVQX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |