C20H24N2 — CID 142975175
1-benzhydryl-3-ethenyl-N-ethylazetidin-3-amine (PubChem CID 142975175) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-benzhydryl-3-ethenyl-N-ethylazetidin-3-amine.
| Compound Name | 1-benzhydryl-3-ethenyl-N-ethylazetidin-3-amine |
|---|---|
| PubChem CID | 142975175 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-benzhydryl-3-ethenyl-N-ethylazetidin-3-amine |
| SMILES | C=CC1(NCC)CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2/c1-3-20(21-4-2)15-22(16-20)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h3,5-14,19,21H,1,4,15-16H2,2H3 |
| InChIKey | VECDXYWFVBLYRN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|