C23H28N2O3 — CID 67843448
1-benzhydryl-4-ethenylpiperazine;3-oxobutanoic acid (PubChem CID 67843448) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-benzhydryl-4-ethenylpiperazine;3-oxobutanoic acid.
| Compound Name | 1-benzhydryl-4-ethenylpiperazine;3-oxobutanoic acid |
|---|---|
| PubChem CID | 67843448 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-benzhydryl-4-ethenylpiperazine;3-oxobutanoic acid |
| SMILES | C=CN1CCN(C(c2ccccc2)c2ccccc2)CC1.CC(=O)CC(=O)O |
| InChI | InChI=1S/C19H22N2.C4H6O3/c1-2-20-13-15-21(16-14-20)19(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-3(5)2-4(6)7/h2-12,19H,1,13-16H2;2H2,1H3,(H,6,7) |
| InChIKey | WJKIITWDZAKQAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|