C21H25N5O4 — CID 122505918
[3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-[2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 122505918) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is [3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-[2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | [3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-[2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 122505918 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | [3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | CCc1nnnn1-c1cc(OC(=O)NCCOCCO)cc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C21H25N5O4/c1-3-20-23-24-25-26(20)18-12-17(16-6-4-15(2)5-7-16)13-19(14-18)30-21(28)22-8-10-29-11-9-27/h4-7,12-14,27H,3,8-11H2,1-2H3,(H,22,28) |
| InChIKey | MMZKVDRKWTXUQK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|