C23H23N7O2 — CID 122635642
[3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-(1-pyridazin-3-ylethyl)carbamate (PubChem CID 122635642) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is [3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-(1-pyridazin-3-ylethyl)carbamate.
| Compound Name | [3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-(1-pyridazin-3-ylethyl)carbamate |
|---|---|
| PubChem CID | 122635642 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)phenyl] N-(1-pyridazin-3-ylethyl)carbamate |
| SMILES | CCc1nnnn1-c1cc(OC(=O)NC(C)c2cccnn2)cc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H23N7O2/c1-4-22-27-28-29-30(22)19-12-18(17-9-7-15(2)8-10-17)13-20(14-19)32-23(31)25-16(3)21-6-5-11-24-26-21/h5-14,16H,4H2,1-3H3,(H,25,31) |
| InChIKey | AIVDFVCWKRBUNG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |