C19H18N2O2S2 — CID 122506051
N-[3-methyl-4-(4-methyl-3-pyridinyl)phenyl]-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonamide (PubChem CID 122506051) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[3-methyl-4-(4-methyl-3-pyridinyl)phenyl]-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | N-[3-methyl-4-(4-methyl-3-pyridinyl)phenyl]-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 122506051 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[3-methyl-4-(4-methyl-3-pyridinyl)phenyl]-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)C2=CC(=S)CC=C2)ccc1-c1cnccc1C |
| InChI | InChI=1S/C19H18N2O2S2/c1-13-8-9-20-12-19(13)18-7-6-15(10-14(18)2)21-25(22,23)17-5-3-4-16(24)11-17/h3,5-12,21H,4H2,1-2H3 |
| InChIKey | JQCADBJOOUACHJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|