C20H14ClF2N3O — CID 122506754
6-[2-(chloromethyl)-4-fluorophenyl]-2-[(4-fluorophenoxy)methyl]imidazo[1,2-a]pyrimidine (PubChem CID 122506754) has the molecular formula C20H14ClF2N3O and a molecular weight of 385.80 g/mol. Its IUPAC name is 6-[2-(chloromethyl)-4-fluorophenyl]-2-[(4-fluorophenoxy)methyl]imidazo[1,2-a]pyrimidine.
| Compound Name | 6-[2-(chloromethyl)-4-fluorophenyl]-2-[(4-fluorophenoxy)methyl]imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 122506754 |
| Molecular Formula | C20H14ClF2N3O |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 6-[2-(chloromethyl)-4-fluorophenyl]-2-[(4-fluorophenoxy)methyl]imidazo[1,2-a]pyrimidine |
| SMILES | Fc1ccc(OCc2cn3cc(-c4ccc(F)cc4CCl)cnc3n2)cc1 |
| InChI | InChI=1S/C20H14ClF2N3O/c21-8-13-7-16(23)3-6-19(13)14-9-24-20-25-17(11-26(20)10-14)12-27-18-4-1-15(22)2-5-18/h1-7,9-11H,8,12H2 |
| InChIKey | TWVLLVICEGLQRC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|