C21H17F2N3O3S — CID 122507174
2-(2,6-difluorophenyl)-4-[(2,2-dihydroxy-1,3-dihydro-2-benzothiophen-5-yl)amino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 122507174) has the molecular formula C21H17F2N3O3S and a molecular weight of 429.45 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[(2,2-dihydroxy-1,3-dihydro-2-benzothiophen-5-yl)amino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-4-[(2,2-dihydroxy-1,3-dihydro-2-benzothiophen-5-yl)amino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 122507174 |
| Molecular Formula | C21H17F2N3O3S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[(2,2-dihydroxy-1,3-dihydro-2-benzothiophen-5-yl)amino]-6,7-dihydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NCc2nc(-c3c(F)cccc3F)cc(Nc3ccc4c(c3)CS(O)(O)C4)c21 |
| InChI | InChI=1S/C21H17F2N3O3S/c22-14-2-1-3-15(23)19(14)16-7-17(20-18(26-16)8-24-21(20)27)25-13-5-4-11-9-30(28,29)10-12(11)6-13/h1-7,28-29H,8-10H2,(H,24,27)(H,25,26) |
| InChIKey | WPZJMICOOCNXDZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |