C21H31NO3S — CID 122508369
2-[2-[cyclohexanecarbonyl(3-methylbutyl)amino]-4-methylphenyl]sulfanylacetic acid (PubChem CID 122508369) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is 2-[2-[cyclohexanecarbonyl(3-methylbutyl)amino]-4-methylphenyl]sulfanylacetic acid.
| Compound Name | 2-[2-[cyclohexanecarbonyl(3-methylbutyl)amino]-4-methylphenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 122508369 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[2-[cyclohexanecarbonyl(3-methylbutyl)amino]-4-methylphenyl]sulfanylacetic acid |
| SMILES | Cc1ccc(SCC(=O)O)c(N(CCC(C)C)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H31NO3S/c1-15(2)11-12-22(21(25)17-7-5-4-6-8-17)18-13-16(3)9-10-19(18)26-14-20(23)24/h9-10,13,15,17H,4-8,11-12,14H2,1-3H3,(H,23,24) |
| InChIKey | VSJFLBJMSSFLMX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |