C18H25NO3 — CID 82321395
3-[N-(cyclohexanecarbonyl)-2,5-dimethylanilino]propanoic acid (PubChem CID 82321395) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-[N-(cyclohexanecarbonyl)-2,5-dimethylanilino]propanoic acid.
| Compound Name | 3-[N-(cyclohexanecarbonyl)-2,5-dimethylanilino]propanoic acid |
|---|---|
| PubChem CID | 82321395 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-[N-(cyclohexanecarbonyl)-2,5-dimethylanilino]propanoic acid |
| SMILES | Cc1ccc(C)c(N(CCC(=O)O)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C18H25NO3/c1-13-8-9-14(2)16(12-13)19(11-10-17(20)21)18(22)15-6-4-3-5-7-15/h8-9,12,15H,3-7,10-11H2,1-2H3,(H,20,21) |
| InChIKey | QXPOJAMZSJKGIW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |