C23H22N6O2 — CID 122508413
8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-propylpurine-2,6-dione (PubChem CID 122508413) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-propylpurine-2,6-dione.
| Compound Name | 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 122508413 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2c1nc(Cc1nc3ccccc3[nH]1)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H22N6O2/c1-2-12-28-21-20(22(30)27-23(28)31)29(14-15-8-4-3-5-9-15)19(26-21)13-18-24-16-10-6-7-11-17(16)25-18/h3-11H,2,12-14H2,1H3,(H,24,25)(H,27,30,31) |
| InChIKey | CRJSCQHFVZPKAE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |