About 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine
6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine (PubChem CID 122510502) has the molecular formula C16H10F2N4
and a molecular weight of 296.28 g/mol. Its IUPAC name is 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine |
| PubChem CID | 122510502 |
| Molecular Formula | C16H10F2N4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine |
| SMILES | Fc1ccc(-c2[nH]cnc2-c2ccc3nccn3c2)cc1F |
| InChI | InChI=1S/C16H10F2N4/c17-12-3-1-10(7-13(12)18)15-16(21-9-20-15)11-2-4-14-19-5-6-22(14)8-11/h1-9H,(H,20,21) |
| InChIKey | IDZKZOVWKKCQCH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine?
The IUPAC name of 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine (CID 122510502) is 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine?
The canonical SMILES for 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine is Fc1ccc(-c2[nH]cnc2-c2ccc3nccn3c2)cc1F.
What is the InChIKey of 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine?
The InChIKey is IDZKZOVWKKCQCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N4/c17-12-3-1-10(7-13(12)18)15-16(21-9-20-15)11-2-4-14-19-5-6-22(14)8-11/h1-9H,(H,20,21).
What are the key properties of 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine?
6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine has a molecular weight of 296.28 g/mol, XLogP of 3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(3,4-difluorophenyl)-1H-imidazol-4-yl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 122510502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).