C16H27N3O5 — CID 122512544
(3S)-3-(aminomethyl)-5-methylhexanoic acid;N-(2,5-dioxopyrrol-1-yl)butanamide (PubChem CID 122512544) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-5-methylhexanoic acid;N-(2,5-dioxopyrrol-1-yl)butanamide.
| Compound Name | (3S)-3-(aminomethyl)-5-methylhexanoic acid;N-(2,5-dioxopyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 122512544 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (3S)-3-(aminomethyl)-5-methylhexanoic acid;N-(2,5-dioxopyrrol-1-yl)butanamide |
| SMILES | CC(C)CC(CN)CC(=O)O.CCCC(=O)NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H10N2O3.C8H17NO2/c1-2-3-6(11)9-10-7(12)4-5-8(10)13;1-6(2)3-7(5-9)4-8(10)11/h4-5H,2-3H2,1H3,(H,9,11);6-7H,3-5,9H2,1-2H3,(H,10,11) |
| InChIKey | BDGKHROAJZIRRU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|