C16H25N3O5 — CID 122541548
3-[[amino-[4-(2,5-dioxopyrrol-1-yl)butanoyl]amino]methyl]-5-methylhexanoic acid (PubChem CID 122541548) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-[[amino-[4-(2,5-dioxopyrrol-1-yl)butanoyl]amino]methyl]-5-methylhexanoic acid.
| Compound Name | 3-[[amino-[4-(2,5-dioxopyrrol-1-yl)butanoyl]amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 122541548 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-[[amino-[4-(2,5-dioxopyrrol-1-yl)butanoyl]amino]methyl]-5-methylhexanoic acid |
| SMILES | CC(C)CC(CC(=O)O)CN(N)C(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H25N3O5/c1-11(2)8-12(9-16(23)24)10-19(17)15(22)4-3-7-18-13(20)5-6-14(18)21/h5-6,11-12H,3-4,7-10,17H2,1-2H3,(H,23,24) |
| InChIKey | DNXSYGXVBUKBQQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|