C19H13FN4O4 — CID 122513686
1-N-[6-(2-fluorophenyl)-3-pyridinyl]-2-nitrobenzene-1,4-dicarboxamide (PubChem CID 122513686) has the molecular formula C19H13FN4O4 and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-N-[6-(2-fluorophenyl)-3-pyridinyl]-2-nitrobenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[6-(2-fluorophenyl)-3-pyridinyl]-2-nitrobenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 122513686 |
| Molecular Formula | C19H13FN4O4 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-N-[6-(2-fluorophenyl)-3-pyridinyl]-2-nitrobenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2ccc(-c3ccccc3F)nc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13FN4O4/c20-15-4-2-1-3-13(15)16-8-6-12(10-22-16)23-19(26)14-7-5-11(18(21)25)9-17(14)24(27)28/h1-10H,(H2,21,25)(H,23,26) |
| InChIKey | VULFSCZVMOKHJG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|