C12H11ClN4O2 — CID 122517687
1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarboxamide (PubChem CID 122517687) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 122517687 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarboxamide |
| SMILES | NC(=O)c1ncn(Cc2cccc(Cl)c2)c1C(N)=O |
| InChI | InChI=1S/C12H11ClN4O2/c13-8-3-1-2-7(4-8)5-17-6-16-9(11(14)18)10(17)12(15)19/h1-4,6H,5H2,(H2,14,18)(H2,15,19) |
| InChIKey | ZRYRRWSIICKYQU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |