C18H20ClFN6S — CID 122518644
2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-[(3R)-1-ethylsulfanylpiperidin-3-yl]-5-fluoropyrimidin-4-amine (PubChem CID 122518644) has the molecular formula C18H20ClFN6S and a molecular weight of 406.92 g/mol. Its IUPAC name is 2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-[(3R)-1-ethylsulfanylpiperidin-3-yl]-5-fluoropyrimidin-4-amine.
| Compound Name | 2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-[(3R)-1-ethylsulfanylpiperidin-3-yl]-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 122518644 |
| Molecular Formula | C18H20ClFN6S |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-[(3R)-1-ethylsulfanylpiperidin-3-yl]-5-fluoropyrimidin-4-amine |
| SMILES | CCSN1CCC[C@@H](Nc2nc(-c3c[nH]c4ncc(Cl)cc34)ncc2F)C1 |
| InChI | InChI=1S/C18H20ClFN6S/c1-2-27-26-5-3-4-12(10-26)24-18-15(20)9-23-17(25-18)14-8-22-16-13(14)6-11(19)7-21-16/h6-9,12H,2-5,10H2,1H3,(H,21,22)(H,23,24,25)/t12-/m1/s1 |
| InChIKey | PJHFOMORCLITGO-GFCCVEGCSA-N |
| XLogP | 4.36 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|