C18H21ClFN7O — CID 126686607
amino-[4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]azepan-1-yl]methanol (PubChem CID 126686607) has the molecular formula C18H21ClFN7O and a molecular weight of 405.87 g/mol. Its IUPAC name is amino-[4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]azepan-1-yl]methanol.
| Compound Name | amino-[4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]azepan-1-yl]methanol |
|---|---|
| PubChem CID | 126686607 |
| Molecular Formula | C18H21ClFN7O |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | amino-[4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]azepan-1-yl]methanol |
| SMILES | NC(O)N1CCCC(Nc2nc(-c3c[nH]c4ncc(Cl)cc34)ncc2F)CC1 |
| InChI | InChI=1S/C18H21ClFN7O/c19-10-6-12-13(8-23-15(12)22-7-10)16-24-9-14(20)17(26-16)25-11-2-1-4-27(5-3-11)18(21)28/h6-9,11,18,28H,1-5,21H2,(H,22,23)(H,24,25,26) |
| InChIKey | ANMIAVXHGSPTHQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|