C8H16NO3+ — CID 122518924
methyl 3-[(3R)-3-methyl-1,3-oxazolidin-3-ium-3-yl]propanoate (PubChem CID 122518924) has the molecular formula C8H16NO3+ and a molecular weight of 174.22 g/mol. Its IUPAC name is methyl 3-[(3R)-3-methyl-1,3-oxazolidin-3-ium-3-yl]propanoate.
| Compound Name | methyl 3-[(3R)-3-methyl-1,3-oxazolidin-3-ium-3-yl]propanoate |
|---|---|
| PubChem CID | 122518924 |
| Molecular Formula | C8H16NO3+ |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | methyl 3-[(3R)-3-methyl-1,3-oxazolidin-3-ium-3-yl]propanoate |
| SMILES | COC(=O)CC[N@+]1(C)CCOC1 |
| InChI | InChI=1S/C8H16NO3/c1-9(5-6-12-7-9)4-3-8(10)11-2/h3-7H2,1-2H3/q+1/t9-/m1/s1 |
| InChIKey | FFNAHXZGPUJYEY-SECBINFHSA-N |
| XLogP | -0.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|