C27H26FN7O2 — CID 122520868
4-(1-acetyl-4-fluoro-2-methylindol-5-yl)oxy-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carbonitrile (PubChem CID 122520868) has the molecular formula C27H26FN7O2 and a molecular weight of 499.55 g/mol. Its IUPAC name is 4-(1-acetyl-4-fluoro-2-methylindol-5-yl)oxy-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carbonitrile.
| Compound Name | 4-(1-acetyl-4-fluoro-2-methylindol-5-yl)oxy-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 122520868 |
| Molecular Formula | C27H26FN7O2 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 4-(1-acetyl-4-fluoro-2-methylindol-5-yl)oxy-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carbonitrile |
| SMILES | CC(=O)n1c(C)cc2c(F)c(Oc3ncnc(Nc4ccc(N5CCN(C)CC5)cc4)c3C#N)ccc21 |
| InChI | InChI=1S/C27H26FN7O2/c1-17-14-21-23(35(17)18(2)36)8-9-24(25(21)28)37-27-22(15-29)26(30-16-31-27)32-19-4-6-20(7-5-19)34-12-10-33(3)11-13-34/h4-9,14,16H,10-13H2,1-3H3,(H,30,31,32) |
| InChIKey | LPHYBFNQFSSVMY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|