C29H28FN7O2 — CID 140890835
cyclopropyl-[4-fluoro-5-[5-isocyano-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxy-2-methylindol-1-yl]methanone (PubChem CID 140890835) has the molecular formula C29H28FN7O2 and a molecular weight of 525.59 g/mol. Its IUPAC name is cyclopropyl-[4-fluoro-5-[5-isocyano-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxy-2-methylindol-1-yl]methanone.
| Compound Name | cyclopropyl-[4-fluoro-5-[5-isocyano-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxy-2-methylindol-1-yl]methanone |
|---|---|
| PubChem CID | 140890835 |
| Molecular Formula | C29H28FN7O2 |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | cyclopropyl-[4-fluoro-5-[5-isocyano-6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxy-2-methylindol-1-yl]methanone |
| SMILES | [C-]#[N+]c1c(Nc2ccc(N3CCN(C)CC3)cc2)ncnc1Oc1ccc2c(cc(C)n2C(=O)C2CC2)c1F |
| InChI | InChI=1S/C29H28FN7O2/c1-18-16-22-23(37(18)29(38)19-4-5-19)10-11-24(25(22)30)39-28-26(31-2)27(32-17-33-28)34-20-6-8-21(9-7-20)36-14-12-35(3)13-15-36/h6-11,16-17,19H,4-5,12-15H2,1,3H3,(H,32,33,34) |
| InChIKey | HNNXUUGHFABSFK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|