C25H23F2N7O — CID 158616176
6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimidin-4-amine (PubChem CID 158616176) has the molecular formula C25H23F2N7O and a molecular weight of 475.50 g/mol. Its IUPAC name is 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimidin-4-amine.
| Compound Name | 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 158616176 |
| Molecular Formula | C25H23F2N7O |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimidin-4-amine |
| SMILES | [C-]#[N+]c1c(Nc2ccc(N3CCN(C)CC3)nc2)ncnc1Oc1cc(F)c2c(c1F)C=C(C)C2 |
| InChI | InChI=1S/C25H23F2N7O/c1-15-10-17-18(11-15)22(27)20(12-19(17)26)35-25-23(28-2)24(30-14-31-25)32-16-4-5-21(29-13-16)34-8-6-33(3)7-9-34/h4-5,11-14H,6-10H2,1,3H3,(H,30,31,32) |
| InChIKey | OKTNZEPKZYQIJG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|