C21H14F2N4O2 — CID 161000594
2-[[6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyanopyrimidin-4-yl]amino]phenol (PubChem CID 161000594) has the molecular formula C21H14F2N4O2 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-[[6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyanopyrimidin-4-yl]amino]phenol.
| Compound Name | 2-[[6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyanopyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 161000594 |
| Molecular Formula | C21H14F2N4O2 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[[6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyanopyrimidin-4-yl]amino]phenol |
| SMILES | [C-]#[N+]c1c(Nc2ccccc2O)ncnc1Oc1cc(F)c2c(c1F)C=C(C)C2 |
| InChI | InChI=1S/C21H14F2N4O2/c1-11-7-12-13(8-11)18(23)17(9-14(12)22)29-21-19(24-2)20(25-10-26-21)27-15-5-3-4-6-16(15)28/h3-6,8-10,28H,7H2,1H3,(H,25,26,27) |
| InChIKey | TVUYTQYGFJOLGG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|