C23H19FN4O3S — CID 147885557
6-[(4-fluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[4-(methylsulfonylmethyl)phenyl]pyrimidin-4-amine (PubChem CID 147885557) has the molecular formula C23H19FN4O3S and a molecular weight of 450.50 g/mol. Its IUPAC name is 6-[(4-fluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[4-(methylsulfonylmethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-[(4-fluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[4-(methylsulfonylmethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 147885557 |
| Molecular Formula | C23H19FN4O3S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 6-[(4-fluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-[4-(methylsulfonylmethyl)phenyl]pyrimidin-4-amine |
| SMILES | [C-]#[N+]c1c(Nc2ccc(CS(C)(=O)=O)cc2)ncnc1Oc1ccc2c(c1F)C=C(C)C2 |
| InChI | InChI=1S/C23H19FN4O3S/c1-14-10-16-6-9-19(20(24)18(16)11-14)31-23-21(25-2)22(26-13-27-23)28-17-7-4-15(5-8-17)12-32(3,29)30/h4-9,11,13H,10,12H2,1,3H3,(H,26,27,28) |
| InChIKey | IBGKMERYCOCZHO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|