C24H22F3N5O — CID 161414664
6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-fluoro-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine (PubChem CID 161414664) has the molecular formula C24H22F3N5O and a molecular weight of 453.47 g/mol. Its IUPAC name is 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-fluoro-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine.
| Compound Name | 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-fluoro-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 161414664 |
| Molecular Formula | C24H22F3N5O |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-fluoro-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine |
| SMILES | CC1=Cc2c(F)c(Oc3ncnc(Nc4ccc(N5CCNCC5)cc4)c3F)cc(F)c2C1 |
| InChI | InChI=1S/C24H22F3N5O/c1-14-10-17-18(11-14)21(26)20(12-19(17)25)33-24-22(27)23(29-13-30-24)31-15-2-4-16(5-3-15)32-8-6-28-7-9-32/h2-5,11-13,28H,6-10H2,1H3,(H,29,30,31) |
| InChIKey | GQPYMZREQLUJIY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|