C28H34FN9O2 — CID 145145188
6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(nitrosomethyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine;piperazine (PubChem CID 145145188) has the molecular formula C28H34FN9O2 and a molecular weight of 547.64 g/mol. Its IUPAC name is 6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(nitrosomethyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine;piperazine.
| Compound Name | 6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(nitrosomethyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine;piperazine |
|---|---|
| PubChem CID | 145145188 |
| Molecular Formula | C28H34FN9O2 |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-(nitrosomethyl)-N-(4-piperazin-1-ylphenyl)pyrimidin-4-amine;piperazine |
| SMILES | C1CNCCN1.Cc1cc2c(F)c(Oc3ncnc(Nc4ccc(N5CCNCC5)cc4)c3CN=O)ccc2[nH]1 |
| InChI | InChI=1S/C24H24FN7O2.C4H10N2/c1-15-12-18-20(30-15)6-7-21(22(18)25)34-24-19(13-29-33)23(27-14-28-24)31-16-2-4-17(5-3-16)32-10-8-26-9-11-32;1-2-6-4-3-5-1/h2-7,12,14,26,30H,8-11,13H2,1H3,(H,27,28,31);5-6H,1-4H2 |
| InChIKey | XKNKICADGZCITG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|