C25H26ClFN6O — CID 122520760
5-chloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine (PubChem CID 122520760) has the molecular formula C25H26ClFN6O and a molecular weight of 480.98 g/mol. Its IUPAC name is 5-chloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 122520760 |
| Molecular Formula | C25H26ClFN6O |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 5-chloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncnc(Oc4ccc5[nH]c(C)cc5c4F)c3Cl)cc2)CC1 |
| InChI | InChI=1S/C25H26ClFN6O/c1-3-32-10-12-33(13-11-32)18-6-4-17(5-7-18)31-24-22(26)25(29-15-28-24)34-21-9-8-20-19(23(21)27)14-16(2)30-20/h4-9,14-15,30H,3,10-13H2,1-2H3,(H,28,29,31) |
| InChIKey | JXUQGHPNWKXMJA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|