C26H28FN7O2 — CID 122520593
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-N,N-dimethyl-6-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide (PubChem CID 122520593) has the molecular formula C26H28FN7O2 and a molecular weight of 489.56 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-N,N-dimethyl-6-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide.
| Compound Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-N,N-dimethyl-6-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122520593 |
| Molecular Formula | C26H28FN7O2 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-N,N-dimethyl-6-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide |
| SMILES | Cc1cc2c(F)c(Oc3ncnc(Nc4ccc(N5CCNCC5)cc4)c3C(=O)N(C)C)ccc2[nH]1 |
| InChI | InChI=1S/C26H28FN7O2/c1-16-14-19-20(31-16)8-9-21(23(19)27)36-25-22(26(35)33(2)3)24(29-15-30-25)32-17-4-6-18(7-5-17)34-12-10-28-11-13-34/h4-9,14-15,28,31H,10-13H2,1-3H3,(H,29,30,32) |
| InChIKey | WXQDVUYATTYZDE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|