C20H24F2N4O3 — CID 122525369
2,2-dimethylpropyl (2S)-2-[(4-amino-2,5-difluorobenzoyl)amino]-3-(6-amino-3-pyridinyl)propanoate (PubChem CID 122525369) has the molecular formula C20H24F2N4O3 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[(4-amino-2,5-difluorobenzoyl)amino]-3-(6-amino-3-pyridinyl)propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[(4-amino-2,5-difluorobenzoyl)amino]-3-(6-amino-3-pyridinyl)propanoate |
|---|---|
| PubChem CID | 122525369 |
| Molecular Formula | C20H24F2N4O3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[(4-amino-2,5-difluorobenzoyl)amino]-3-(6-amino-3-pyridinyl)propanoate |
| SMILES | CC(C)(C)COC(=O)[C@H](Cc1ccc(N)nc1)NC(=O)c1cc(F)c(N)cc1F |
| InChI | InChI=1S/C20H24F2N4O3/c1-20(2,3)10-29-19(28)16(6-11-4-5-17(24)25-9-11)26-18(27)12-7-14(22)15(23)8-13(12)21/h4-5,7-9,16H,6,10,23H2,1-3H3,(H2,24,25)(H,26,27)/t16-/m0/s1 |
| InChIKey | UJOKEOIGFPFBJG-INIZCTEOSA-N |
| XLogP | 2.45 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|