C25H27FN6O3 — CID 122525707
[4-[2-(3-cyano-4-fluorophenyl)ethyl]-1-[2-[4-[diazenyl(methanimidoyl)amino]phenyl]acetyl]piperidin-4-yl] acetate (PubChem CID 122525707) has the molecular formula C25H27FN6O3 and a molecular weight of 478.53 g/mol. Its IUPAC name is [4-[2-(3-cyano-4-fluorophenyl)ethyl]-1-[2-[4-[diazenyl(methanimidoyl)amino]phenyl]acetyl]piperidin-4-yl] acetate.
| Compound Name | [4-[2-(3-cyano-4-fluorophenyl)ethyl]-1-[2-[4-[diazenyl(methanimidoyl)amino]phenyl]acetyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 122525707 |
| Molecular Formula | C25H27FN6O3 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [4-[2-(3-cyano-4-fluorophenyl)ethyl]-1-[2-[4-[diazenyl(methanimidoyl)amino]phenyl]acetyl]piperidin-4-yl] acetate |
| SMILES | [H]/N=C/N(/N=N/[H])c1ccc(CC(=O)N2CCC(CCc3ccc(F)c(C#N)c3)(OC(C)=O)CC2)cc1 |
| InChI | InChI=1S/C25H27FN6O3/c1-18(33)35-25(9-8-20-4-7-23(26)21(14-20)16-27)10-12-31(13-11-25)24(34)15-19-2-5-22(6-3-19)32(17-28)30-29/h2-7,14,17,28-29H,8-13,15H2,1H3/b28-17+,30-29+ |
| InChIKey | KWRVNZFKTOHJEJ-UMJYARSTSA-N |
| XLogP | 4.16 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|