C23H21ClFN3O2 — CID 123783814
2-chloro-4-[2-[4-[2-(4-fluoro-3-isocyanophenyl)ethyl]-4-hydroxypiperidin-1-yl]-2-oxoethyl]benzonitrile (PubChem CID 123783814) has the molecular formula C23H21ClFN3O2 and a molecular weight of 425.89 g/mol. Its IUPAC name is 2-chloro-4-[2-[4-[2-(4-fluoro-3-isocyanophenyl)ethyl]-4-hydroxypiperidin-1-yl]-2-oxoethyl]benzonitrile.
| Compound Name | 2-chloro-4-[2-[4-[2-(4-fluoro-3-isocyanophenyl)ethyl]-4-hydroxypiperidin-1-yl]-2-oxoethyl]benzonitrile |
|---|---|
| PubChem CID | 123783814 |
| Molecular Formula | C23H21ClFN3O2 |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-chloro-4-[2-[4-[2-(4-fluoro-3-isocyanophenyl)ethyl]-4-hydroxypiperidin-1-yl]-2-oxoethyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(CCC2(O)CCN(C(=O)Cc3ccc(C#N)c(Cl)c3)CC2)ccc1F |
| InChI | InChI=1S/C23H21ClFN3O2/c1-27-21-13-16(3-5-20(21)25)6-7-23(30)8-10-28(11-9-23)22(29)14-17-2-4-18(15-26)19(24)12-17/h2-5,12-13,30H,6-11,14H2 |
| InChIKey | TWDVDYQKSGHYAE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|