C23H19FN6O2 — CID 123970348
1-[4-[2-(4-fluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone (PubChem CID 123970348) has the molecular formula C23H19FN6O2 and a molecular weight of 430.44 g/mol. Its IUPAC name is 1-[4-[2-(4-fluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[4-[2-(4-fluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 123970348 |
| Molecular Formula | C23H19FN6O2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[4-[2-(4-fluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
| SMILES | [C-]#[N+]c1cc(C#CC2(O)CCN(C(=O)Cc3ccc(-n4cnnn4)cc3)CC2)ccc1F |
| InChI | InChI=1S/C23H19FN6O2/c1-25-21-14-18(4-7-20(21)24)8-9-23(32)10-12-29(13-11-23)22(31)15-17-2-5-19(6-3-17)30-16-26-27-28-30/h2-7,14,16,32H,10-13,15H2 |
| InChIKey | HEJHCFNYQVTAAD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|