C23H18F2N6O2 — CID 123555939
1-[4-[2-(2,4-difluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone (PubChem CID 123555939) has the molecular formula C23H18F2N6O2 and a molecular weight of 448.43 g/mol. Its IUPAC name is 1-[4-[2-(2,4-difluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[4-[2-(2,4-difluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 123555939 |
| Molecular Formula | C23H18F2N6O2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-[4-[2-(2,4-difluoro-3-isocyanophenyl)ethynyl]-4-hydroxypiperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
| SMILES | [C-]#[N+]c1c(F)ccc(C#CC2(O)CCN(C(=O)Cc3ccc(-n4cnnn4)cc3)CC2)c1F |
| InChI | InChI=1S/C23H18F2N6O2/c1-26-22-19(24)7-4-17(21(22)25)8-9-23(33)10-12-30(13-11-23)20(32)14-16-2-5-18(6-3-16)31-15-27-28-29-31/h2-7,15,33H,10-14H2 |
| InChIKey | HFSSMCLTTZPJRH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|