C20H19F2NO3 — CID 120512865
1-[2-(3,4-difluorophenyl)acetyl]-4-phenylpiperidine-4-carboxylic acid (PubChem CID 120512865) has the molecular formula C20H19F2NO3 and a molecular weight of 359.37 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)acetyl]-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-[2-(3,4-difluorophenyl)acetyl]-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 120512865 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)acetyl]-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(Cc1ccc(F)c(F)c1)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H19F2NO3/c21-16-7-6-14(12-17(16)22)13-18(24)23-10-8-20(9-11-23,19(25)26)15-4-2-1-3-5-15/h1-7,12H,8-11,13H2,(H,25,26) |
| InChIKey | FEWGLMGZUWTIEJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |