C16H16F2N2O4 — CID 6735027
4-[4-[2-(3,4-difluorophenyl)acetyl]piperazin-1-yl]-4-oxobut-2-enoic acid (PubChem CID 6735027) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is 4-[4-[2-(3,4-difluorophenyl)acetyl]piperazin-1-yl]-4-oxobut-2-enoic acid.
| Compound Name | 4-[4-[2-(3,4-difluorophenyl)acetyl]piperazin-1-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 6735027 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-[4-[2-(3,4-difluorophenyl)acetyl]piperazin-1-yl]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)N1CCN(C(=O)Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H16F2N2O4/c17-12-2-1-11(9-13(12)18)10-15(22)20-7-5-19(6-8-20)14(21)3-4-16(23)24/h1-4,9H,5-8,10H2,(H,23,24) |
| InChIKey | GAVSRZHMJXAWKL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|