C19H17Cl2NO3 — CID 45433248
1-(2,5-dichlorobenzoyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45433248) has the molecular formula C19H17Cl2NO3 and a molecular weight of 378.25 g/mol. Its IUPAC name is 1-(2,5-dichlorobenzoyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2,5-dichlorobenzoyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45433248 |
| Molecular Formula | C19H17Cl2NO3 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-(2,5-dichlorobenzoyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H17Cl2NO3/c20-14-6-7-16(21)15(12-14)17(23)22-10-8-19(9-11-22,18(24)25)13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,24,25) |
| InChIKey | BBNGLKBTVUNKFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |