C25H26BrClN6O3 — CID 122526119
[2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-cyano-3-methylphenyl]-heptylcarbamic acid (PubChem CID 122526119) has the molecular formula C25H26BrClN6O3 and a molecular weight of 573.88 g/mol. Its IUPAC name is [2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-cyano-3-methylphenyl]-heptylcarbamic acid.
| Compound Name | [2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-cyano-3-methylphenyl]-heptylcarbamic acid |
|---|---|
| PubChem CID | 122526119 |
| Molecular Formula | C25H26BrClN6O3 |
| Molecular Weight | 573.88 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | [2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]-5-cyano-3-methylphenyl]-heptylcarbamic acid |
| SMILES | CCCCCCCN(C(=O)O)c1cc(C#N)cc(C)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C25H26BrClN6O3/c1-3-4-5-6-7-11-32(25(35)36)19-13-17(15-28)12-16(2)22(19)30-24(34)20-14-21(26)31-33(20)23-18(27)9-8-10-29-23/h8-10,12-14H,3-7,11H2,1-2H3,(H,30,34)(H,35,36) |
| InChIKey | AOJBWORGBBVUPE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.88 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|