C21H19BrClN7O2 — CID 134562074
3-bromo-1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-[ethyl(methylamino)carbamoyl]-6-methylphenyl]pyrazole-5-carboxamide (PubChem CID 134562074) has the molecular formula C21H19BrClN7O2 and a molecular weight of 516.79 g/mol. Its IUPAC name is 3-bromo-1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-[ethyl(methylamino)carbamoyl]-6-methylphenyl]pyrazole-5-carboxamide.
| Compound Name | 3-bromo-1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-[ethyl(methylamino)carbamoyl]-6-methylphenyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 134562074 |
| Molecular Formula | C21H19BrClN7O2 |
| Molecular Weight | 516.79 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 3-bromo-1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-[ethyl(methylamino)carbamoyl]-6-methylphenyl]pyrazole-5-carboxamide |
| SMILES | CCN(NC)C(=O)c1cc(C#N)cc(C)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C21H19BrClN7O2/c1-4-29(25-3)21(32)14-9-13(11-24)8-12(2)18(14)27-20(31)16-10-17(22)28-30(16)19-15(23)6-5-7-26-19/h5-10,25H,4H2,1-3H3,(H,27,31) |
| InChIKey | OWKWYCXGRSXFJP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|