C19H24N6O3S — CID 122526547
1-[2-[4,6-dimethoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidin-4-yl]but-3-en-2-one (PubChem CID 122526547) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-[2-[4,6-dimethoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidin-4-yl]but-3-en-2-one.
| Compound Name | 1-[2-[4,6-dimethoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidin-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 122526547 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-[2-[4,6-dimethoxy-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylpyrimidin-4-yl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccnc(Sc2c(OC)nc(N3CCN(C)CC3)nc2OC)n1 |
| InChI | InChI=1S/C19H24N6O3S/c1-5-14(26)12-13-6-7-20-19(21-13)29-15-16(27-3)22-18(23-17(15)28-4)25-10-8-24(2)9-11-25/h5-7H,1,8-12H2,2-4H3 |
| InChIKey | FJBBXASQIJDFGA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|