C34H32F3N5O6 — CID 122531401
(2S)-N-[(3S)-1-(4-acetylbenzoyl)-5-[[1-oxido-3-(2,2,2-trifluoroethoxy)quinolin-1-ium-4-yl]methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide (PubChem CID 122531401) has the molecular formula C34H32F3N5O6 and a molecular weight of 663.65 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-(4-acetylbenzoyl)-5-[[1-oxido-3-(2,2,2-trifluoroethoxy)quinolin-1-ium-4-yl]methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(3S)-1-(4-acetylbenzoyl)-5-[[1-oxido-3-(2,2,2-trifluoroethoxy)quinolin-1-ium-4-yl]methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 122531401 |
| Molecular Formula | C34H32F3N5O6 |
| Molecular Weight | 663.65 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | (2S)-N-[(3S)-1-(4-acetylbenzoyl)-5-[[1-oxido-3-(2,2,2-trifluoroethoxy)quinolin-1-ium-4-yl]methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H]1CN(C(=O)c2ccc(C(C)=O)cc2)c2ccccc2N(Cc2c(OCC(F)(F)F)c[n+]([O-])c3ccccc23)C1=O |
| InChI | InChI=1S/C34H32F3N5O6/c1-20(38-3)31(44)39-26-17-41(32(45)23-14-12-22(13-15-23)21(2)43)29-11-7-6-10-28(29)40(33(26)46)16-25-24-8-4-5-9-27(24)42(47)18-30(25)48-19-34(35,36)37/h4-15,18,20,26,38H,16-17,19H2,1-3H3,(H,39,44)/t20-,26-/m0/s1 |
| InChIKey | NAPUAFOAUICUGC-FNZWTVRRSA-N |
| XLogP | 3.90 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|