C23H29N3O — CID 122533484
1-[[(1R)-2-azido-1-phenylethoxy]methyl]-4-(2-cyclohexylethyl)benzene (PubChem CID 122533484) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[[(1R)-2-azido-1-phenylethoxy]methyl]-4-(2-cyclohexylethyl)benzene.
| Compound Name | 1-[[(1R)-2-azido-1-phenylethoxy]methyl]-4-(2-cyclohexylethyl)benzene |
|---|---|
| PubChem CID | 122533484 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[[(1R)-2-azido-1-phenylethoxy]methyl]-4-(2-cyclohexylethyl)benzene |
| SMILES | [N-]=[N+]=NC[C@H](OCc1ccc(CCC2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O/c24-26-25-17-23(22-9-5-2-6-10-22)27-18-21-15-13-20(14-16-21)12-11-19-7-3-1-4-8-19/h2,5-6,9-10,13-16,19,23H,1,3-4,7-8,11-12,17-18H2/t23-/m0/s1 |
| InChIKey | MMZAXUVYXQGONU-QHCPKHFHSA-N |
| XLogP | 6.77 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|